C13H16N2O5S — CID 7524490
[(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate (PubChem CID 7524490) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate.
| Compound Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7524490 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate |
| SMILES | Cc1ccc(C(=O)CCC(=O)O[C@@H](C)C(=O)NC(N)=O)s1 |
| InChI | InChI=1S/C13H16N2O5S/c1-7-3-5-10(21-7)9(16)4-6-11(17)20-8(2)12(18)15-13(14)19/h3,5,8H,4,6H2,1-2H3,(H3,14,15,18,19)/t8-/m0/s1 |
| InChIKey | RGWLDJNXSJWSDQ-QMMMGPOBSA-N |
| XLogP | 1.15 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |