C18H18O4S — CID 55367802
(1-oxo-1-phenylpropan-2-yl) 4-(5-methylthiophen-2-yl)-4-oxobutanoate (PubChem CID 55367802) has the molecular formula C18H18O4S and a molecular weight of 330.40 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) 4-(5-methylthiophen-2-yl)-4-oxobutanoate.
| Compound Name | (1-oxo-1-phenylpropan-2-yl) 4-(5-methylthiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 55367802 |
| Molecular Formula | C18H18O4S |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) 4-(5-methylthiophen-2-yl)-4-oxobutanoate |
| SMILES | Cc1ccc(C(=O)CCC(=O)OC(C)C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C18H18O4S/c1-12-8-10-16(23-12)15(19)9-11-17(20)22-13(2)18(21)14-6-4-3-5-7-14/h3-8,10,13H,9,11H2,1-2H3 |
| InChIKey | FSYYIIUSPRYUFI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |