C18H18O3S — CID 55367907
[(E)-3-phenylprop-2-enyl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate (PubChem CID 55367907) has the molecular formula C18H18O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is [(E)-3-phenylprop-2-enyl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate.
| Compound Name | [(E)-3-phenylprop-2-enyl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 55367907 |
| Molecular Formula | C18H18O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | [(E)-3-phenylprop-2-enyl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate |
| SMILES | Cc1ccc(C(=O)CCC(=O)OC/C=C/c2ccccc2)s1 |
| InChI | InChI=1S/C18H18O3S/c1-14-9-11-17(22-14)16(19)10-12-18(20)21-13-5-8-15-6-3-2-4-7-15/h2-9,11H,10,12-13H2,1H3/b8-5+ |
| InChIKey | PCOUZGBETZFVTF-VMPITWQZSA-N |
| XLogP | 4.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |