C16H20O4S — CID 78862381
2-methylprop-2-enyl 7-(5-methylthiophen-2-yl)-4,7-dioxoheptanoate (PubChem CID 78862381) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-methylprop-2-enyl 7-(5-methylthiophen-2-yl)-4,7-dioxoheptanoate.
| Compound Name | 2-methylprop-2-enyl 7-(5-methylthiophen-2-yl)-4,7-dioxoheptanoate |
|---|---|
| PubChem CID | 78862381 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-methylprop-2-enyl 7-(5-methylthiophen-2-yl)-4,7-dioxoheptanoate |
| SMILES | C=C(C)COC(=O)CCC(=O)CCC(=O)c1ccc(C)s1 |
| InChI | InChI=1S/C16H20O4S/c1-11(2)10-20-16(19)9-6-13(17)5-7-14(18)15-8-4-12(3)21-15/h4,8H,1,5-7,9-10H2,2-3H3 |
| InChIKey | CRVNCQSRBZOCEL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|