C25H26ClN3O4 — CID 42920367
methyl 3-(2-chlorophenyl)-3-[(13-oxo-6,7,8,9,10,11-hexahydroazocino[2,1-b]quinazoline-3-carbonyl)amino]propanoate (PubChem CID 42920367) has the molecular formula C25H26ClN3O4 and a molecular weight of 467.95 g/mol. Its IUPAC name is methyl 3-(2-chlorophenyl)-3-[(13-oxo-6,7,8,9,10,11-hexahydroazocino[2,1-b]quinazoline-3-carbonyl)amino]propanoate.
| Compound Name | methyl 3-(2-chlorophenyl)-3-[(13-oxo-6,7,8,9,10,11-hexahydroazocino[2,1-b]quinazoline-3-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 42920367 |
| Molecular Formula | C25H26ClN3O4 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | methyl 3-(2-chlorophenyl)-3-[(13-oxo-6,7,8,9,10,11-hexahydroazocino[2,1-b]quinazoline-3-carbonyl)amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1ccc2c(=O)n3c(nc2c1)CCCCCC3)c1ccccc1Cl |
| InChI | InChI=1S/C25H26ClN3O4/c1-33-23(30)15-21(17-8-5-6-9-19(17)26)28-24(31)16-11-12-18-20(14-16)27-22-10-4-2-3-7-13-29(22)25(18)32/h5-6,8-9,11-12,14,21H,2-4,7,10,13,15H2,1H3,(H,28,31) |
| InChIKey | ASJMBKUWOWAJHW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |