C14H15FN2O3 — CID 42921245
5-(4-fluorophenyl)-3-(oxan-2-ylmethyl)-1,3,4-oxadiazol-2-one (PubChem CID 42921245) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3-(oxan-2-ylmethyl)-1,3,4-oxadiazol-2-one.
| Compound Name | 5-(4-fluorophenyl)-3-(oxan-2-ylmethyl)-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 42921245 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 5-(4-fluorophenyl)-3-(oxan-2-ylmethyl)-1,3,4-oxadiazol-2-one |
| SMILES | O=c1oc(-c2ccc(F)cc2)nn1CC1CCCCO1 |
| InChI | InChI=1S/C14H15FN2O3/c15-11-6-4-10(5-7-11)13-16-17(14(18)20-13)9-12-3-1-2-8-19-12/h4-7,12H,1-3,8-9H2 |
| InChIKey | YQQXDQMDDXMYAP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |