C21H22Cl2N2O4 — CID 42924031
N-[2-(3,4-dichloroanilino)-2-oxoethyl]-N-methyl-2-(oxolan-2-ylmethoxy)benzamide (PubChem CID 42924031) has the molecular formula C21H22Cl2N2O4 and a molecular weight of 437.32 g/mol. Its IUPAC name is N-[2-(3,4-dichloroanilino)-2-oxoethyl]-N-methyl-2-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[2-(3,4-dichloroanilino)-2-oxoethyl]-N-methyl-2-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 42924031 |
| Molecular Formula | C21H22Cl2N2O4 |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | N-[2-(3,4-dichloroanilino)-2-oxoethyl]-N-methyl-2-(oxolan-2-ylmethoxy)benzamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)c1ccccc1OCC1CCCO1 |
| InChI | InChI=1S/C21H22Cl2N2O4/c1-25(12-20(26)24-14-8-9-17(22)18(23)11-14)21(27)16-6-2-3-7-19(16)29-13-15-5-4-10-28-15/h2-3,6-9,11,15H,4-5,10,12-13H2,1H3,(H,24,26) |
| InChIKey | FRIDODVUVCCBRX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |