C18H24N4O6S — CID 42925286
N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-ethylethanesulfonamide (PubChem CID 42925286) has the molecular formula C18H24N4O6S and a molecular weight of 424.48 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-ethylethanesulfonamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 42925286 |
| Molecular Formula | C18H24N4O6S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-ethylethanesulfonamide |
| SMILES | CCN(CC1COc2ccccc2O1)S(=O)(=O)CCn1nc(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C18H24N4O6S/c1-4-20(11-15-12-27-16-7-5-6-8-17(16)28-15)29(25,26)10-9-21-14(3)18(22(23)24)13(2)19-21/h5-8,15H,4,9-12H2,1-3H3 |
| InChIKey | VJDAVDVQCSTQCL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 116.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|