C22H29N5O5S — CID 42926850
5,5-dioxo-4-[5-oxo-5-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]pentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 42926850) has the molecular formula C22H29N5O5S and a molecular weight of 475.57 g/mol. Its IUPAC name is 5,5-dioxo-4-[5-oxo-5-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]pentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | 5,5-dioxo-4-[5-oxo-5-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]pentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 42926850 |
| Molecular Formula | C22H29N5O5S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 5,5-dioxo-4-[5-oxo-5-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]pentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | O=C1NC2CS(=O)(=O)C(CCCCC(=O)N3CCC(n4c(=O)[nH]c5ccccc54)CC3)C2N1 |
| InChI | InChI=1S/C22H29N5O5S/c28-19(8-4-3-7-18-20-16(13-33(18,31)32)23-21(29)25-20)26-11-9-14(10-12-26)27-17-6-2-1-5-15(17)24-22(27)30/h1-2,5-6,14,16,18,20H,3-4,7-13H2,(H,24,30)(H2,23,25,29) |
| InChIKey | OPCNPBGFGQNMEB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 133.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|