C20H28BrN3O2 — CID 42927390
N-(2-bromo-4-methylphenyl)-2-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]propanamide (PubChem CID 42927390) has the molecular formula C20H28BrN3O2 and a molecular weight of 422.37 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]propanamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 42927390 |
| Molecular Formula | C20H28BrN3O2 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]propanamide |
| SMILES | Cc1ccc(NC(=O)C(C)N2CCC(C(=O)N3CCCC3)CC2)c(Br)c1 |
| InChI | InChI=1S/C20H28BrN3O2/c1-14-5-6-18(17(21)13-14)22-19(25)15(2)23-11-7-16(8-12-23)20(26)24-9-3-4-10-24/h5-6,13,15-16H,3-4,7-12H2,1-2H3,(H,22,25) |
| InChIKey | LILUHIHNFHIRKY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |