C13H15BrN2O2 — CID 47335620
N-(2-bromo-4-methylphenyl)-2-oxo-2-pyrrolidin-1-ylacetamide (PubChem CID 47335620) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-oxo-2-pyrrolidin-1-ylacetamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-oxo-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 47335620 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-oxo-2-pyrrolidin-1-ylacetamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N2CCCC2)c(Br)c1 |
| InChI | InChI=1S/C13H15BrN2O2/c1-9-4-5-11(10(14)8-9)15-12(17)13(18)16-6-2-3-7-16/h4-5,8H,2-3,6-7H2,1H3,(H,15,17) |
| InChIKey | LJLZKCFGZPHEJU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|