C15H18BrN3O4 — CID 3911009
N'-[2-(2-bromo-4-methylphenoxy)acetyl]-2-oxo-2-pyrrolidin-1-ylacetohydrazide (PubChem CID 3911009) has the molecular formula C15H18BrN3O4 and a molecular weight of 384.23 g/mol. Its IUPAC name is N'-[2-(2-bromo-4-methylphenoxy)acetyl]-2-oxo-2-pyrrolidin-1-ylacetohydrazide.
| Compound Name | N'-[2-(2-bromo-4-methylphenoxy)acetyl]-2-oxo-2-pyrrolidin-1-ylacetohydrazide |
|---|---|
| PubChem CID | 3911009 |
| Molecular Formula | C15H18BrN3O4 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | N'-[2-(2-bromo-4-methylphenoxy)acetyl]-2-oxo-2-pyrrolidin-1-ylacetohydrazide |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)C(=O)N2CCCC2)c(Br)c1 |
| InChI | InChI=1S/C15H18BrN3O4/c1-10-4-5-12(11(16)8-10)23-9-13(20)17-18-14(21)15(22)19-6-2-3-7-19/h4-5,8H,2-3,6-7,9H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | NCKIXZFRMYKXOT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|