C17H21BrN2O5 — CID 11839049
cis-(1S,2R)-2-[[[2-(2-bromo-4-methylphenoxy)acetyl]amino]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 11839049) has the molecular formula C17H21BrN2O5 and a molecular weight of 413.27 g/mol. Its IUPAC name is cis-(1S,2R)-2-[[[2-(2-bromo-4-methylphenoxy)acetyl]amino]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1S,2R)-2-[[[2-(2-bromo-4-methylphenoxy)acetyl]amino]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 11839049 |
| Molecular Formula | C17H21BrN2O5 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | cis-(1S,2R)-2-[[[2-(2-bromo-4-methylphenoxy)acetyl]amino]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)[C@@H]2CCCC[C@@H]2C(=O)O)c(Br)c1 |
| InChI | InChI=1S/C17H21BrN2O5/c1-10-6-7-14(13(18)8-10)25-9-15(21)19-20-16(22)11-4-2-3-5-12(11)17(23)24/h6-8,11-12H,2-5,9H2,1H3,(H,19,21)(H,20,22)(H,23,24)/t11-,12+/m1/s1 |
| InChIKey | GVYLNUGFOUFXTC-NEPJUHHUSA-N |
| XLogP | 2.17 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|