C17H17BrN2O3 — CID 4280300
2-(2-bromo-4-methylphenoxy)-N'-[1-(4-hydroxyphenyl)ethenyl]acetohydrazide (PubChem CID 4280300) has the molecular formula C17H17BrN2O3 and a molecular weight of 377.24 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenoxy)-N'-[1-(4-hydroxyphenyl)ethenyl]acetohydrazide.
| Compound Name | 2-(2-bromo-4-methylphenoxy)-N'-[1-(4-hydroxyphenyl)ethenyl]acetohydrazide |
|---|---|
| PubChem CID | 4280300 |
| Molecular Formula | C17H17BrN2O3 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 2-(2-bromo-4-methylphenoxy)-N'-[1-(4-hydroxyphenyl)ethenyl]acetohydrazide |
| SMILES | C=C(NNC(=O)COc1ccc(C)cc1Br)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H17BrN2O3/c1-11-3-8-16(15(18)9-11)23-10-17(22)20-19-12(2)13-4-6-14(21)7-5-13/h3-9,19,21H,2,10H2,1H3,(H,20,22) |
| InChIKey | BMMQYFDZDLSYRV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|