C20H18FN3O5S — CID 42927586
[1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 7-fluoro-2-methylquinoline-3-carboxylate (PubChem CID 42927586) has the molecular formula C20H18FN3O5S and a molecular weight of 431.45 g/mol. Its IUPAC name is [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 7-fluoro-2-methylquinoline-3-carboxylate.
| Compound Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 7-fluoro-2-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 42927586 |
| Molecular Formula | C20H18FN3O5S |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 7-fluoro-2-methylquinoline-3-carboxylate |
| SMILES | Cc1nc2cc(F)ccc2cc1C(=O)OC(C)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H18FN3O5S/c1-11-17(9-13-3-4-14(21)10-18(13)23-11)20(26)29-12(2)19(25)24-15-5-7-16(8-6-15)30(22,27)28/h3-10,12H,1-2H3,(H,24,25)(H2,22,27,28) |
| InChIKey | GJTJKMSTFTXYRZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |