C21H27N3O5S3 — CID 42928602
2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-4-methylsulfanyl-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)butanamide (PubChem CID 42928602) has the molecular formula C21H27N3O5S3 and a molecular weight of 497.66 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-4-methylsulfanyl-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-4-methylsulfanyl-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 42928602 |
| Molecular Formula | C21H27N3O5S3 |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-4-methylsulfanyl-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)butanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccc2c(c1)OCCO2)C(=O)Nc1nc2c(s1)CC(C)CC2 |
| InChI | InChI=1S/C21H27N3O5S3/c1-13-3-5-15-19(11-13)31-21(22-15)23-20(25)16(7-10-30-2)24-32(26,27)14-4-6-17-18(12-14)29-9-8-28-17/h4,6,12-13,16,24H,3,5,7-11H2,1-2H3,(H,22,23,25) |
| InChIKey | KQURYGFMNFOJBP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |