C19H26F3N3O2 — CID 42930123
N-(4-morpholin-4-ylphenyl)-3-[3-(trifluoromethyl)piperidin-1-yl]propanamide (PubChem CID 42930123) has the molecular formula C19H26F3N3O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-3-[3-(trifluoromethyl)piperidin-1-yl]propanamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-3-[3-(trifluoromethyl)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 42930123 |
| Molecular Formula | C19H26F3N3O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-3-[3-(trifluoromethyl)piperidin-1-yl]propanamide |
| SMILES | O=C(CCN1CCCC(C(F)(F)F)C1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H26F3N3O2/c20-19(21,22)15-2-1-8-24(14-15)9-7-18(26)23-16-3-5-17(6-4-16)25-10-12-27-13-11-25/h3-6,15H,1-2,7-14H2,(H,23,26) |
| InChIKey | NQQAJZJFBTTZAX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|