C20H29F3N4O — CID 25329580
N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-[(3S)-3-(trifluoromethyl)piperidin-1-yl]acetamide (PubChem CID 25329580) has the molecular formula C20H29F3N4O and a molecular weight of 398.47 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-[(3S)-3-(trifluoromethyl)piperidin-1-yl]acetamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-[(3S)-3-(trifluoromethyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 25329580 |
| Molecular Formula | C20H29F3N4O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-[(3S)-3-(trifluoromethyl)piperidin-1-yl]acetamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)CN3CCC[C@H](C(F)(F)F)C3)cc2)CC1 |
| InChI | InChI=1S/C20H29F3N4O/c1-2-25-10-12-27(13-11-25)18-7-5-17(6-8-18)24-19(28)15-26-9-3-4-16(14-26)20(21,22)23/h5-8,16H,2-4,9-15H2,1H3,(H,24,28)/t16-/m0/s1 |
| InChIKey | GAQMYXXCZHBJGH-INIZCTEOSA-N |
| XLogP | 3.04 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|