C22H24F3N3O3 — CID 46801583
N-(2-methoxyphenyl)-4-[[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]amino]benzamide (PubChem CID 46801583) has the molecular formula C22H24F3N3O3 and a molecular weight of 435.45 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-4-[[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]amino]benzamide.
| Compound Name | N-(2-methoxyphenyl)-4-[[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 46801583 |
| Molecular Formula | C22H24F3N3O3 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-(2-methoxyphenyl)-4-[[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]amino]benzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC(=O)CN2CCCC(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C22H24F3N3O3/c1-31-19-7-3-2-6-18(19)27-21(30)15-8-10-17(11-9-15)26-20(29)14-28-12-4-5-16(13-28)22(23,24)25/h2-3,6-11,16H,4-5,12-14H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | LLFIYYOVTAPZLA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |