C25H31N3O3 — CID 11940884
4-[[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]acetyl]amino]-N-(2-methoxyphenyl)benzamide (PubChem CID 11940884) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-[[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]acetyl]amino]-N-(2-methoxyphenyl)benzamide.
| Compound Name | 4-[[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]acetyl]amino]-N-(2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 11940884 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 4-[[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]acetyl]amino]-N-(2-methoxyphenyl)benzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC(=O)CN2CC[C@H]3CCCC[C@@H]3C2)cc1 |
| InChI | InChI=1S/C25H31N3O3/c1-31-23-9-5-4-8-22(23)27-25(30)19-10-12-21(13-11-19)26-24(29)17-28-15-14-18-6-2-3-7-20(18)16-28/h4-5,8-13,18,20H,2-3,6-7,14-17H2,1H3,(H,26,29)(H,27,30)/t18-,20-/m1/s1 |
| InChIKey | GGGROWSMWBVPQS-UYAOXDASSA-N |
| XLogP | 4.40 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |