C20H24F2N4O2 — CID 42930191
N-[2-(cyclohexen-1-yl)ethyl]-2-[(E)-1-[1-(difluoromethyl)benzimidazol-2-yl]ethylideneamino]oxyacetamide (PubChem CID 42930191) has the molecular formula C20H24F2N4O2 and a molecular weight of 390.43 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[(E)-1-[1-(difluoromethyl)benzimidazol-2-yl]ethylideneamino]oxyacetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(E)-1-[1-(difluoromethyl)benzimidazol-2-yl]ethylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 42930191 |
| Molecular Formula | C20H24F2N4O2 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(E)-1-[1-(difluoromethyl)benzimidazol-2-yl]ethylideneamino]oxyacetamide |
| SMILES | C/C(=N\OCC(=O)NCCC1=CCCCC1)c1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C20H24F2N4O2/c1-14(19-24-16-9-5-6-10-17(16)26(19)20(21)22)25-28-13-18(27)23-12-11-15-7-3-2-4-8-15/h5-7,9-10,20H,2-4,8,11-13H2,1H3,(H,23,27)/b25-14+ |
| InChIKey | BAAMAUZYRXAEFC-AFUMVMLFSA-N |
| XLogP | 4.18 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|