C26H30N4O2S — CID 46347507
N-[2-(cyclohexen-1-yl)ethyl]-2-[2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzimidazol-1-yl]acetamide (PubChem CID 46347507) has the molecular formula C26H30N4O2S and a molecular weight of 462.62 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzimidazol-1-yl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 46347507 |
| Molecular Formula | C26H30N4O2S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzimidazol-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nc3ccccc3n2CC(=O)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C26H30N4O2S/c1-19-11-13-21(14-12-19)28-25(32)18-33-26-29-22-9-5-6-10-23(22)30(26)17-24(31)27-16-15-20-7-3-2-4-8-20/h5-7,9-14H,2-4,8,15-18H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | KBUOWLMXJHWLNO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|