About [[amino(pyrazin-2-yl)methylidene]amino] 2-chloroacetate
[[amino(pyrazin-2-yl)methylidene]amino] 2-chloroacetate (PubChem CID 4293110) has the molecular formula C7H7ClN4O2
and a molecular weight of 214.61 g/mol. Its IUPAC name is [[amino(pyrazin-2-yl)methylidene]amino] 2-chloroacetate.
Molecular Properties
| Compound Name | [[amino(pyrazin-2-yl)methylidene]amino] 2-chloroacetate |
| PubChem CID | 4293110 |
| Molecular Formula | C7H7ClN4O2 |
| Molecular Weight | 214.61 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | [[amino(pyrazin-2-yl)methylidene]amino] 2-chloroacetate |
| SMILES | NC(=NOC(=O)CCl)c1cnccn1 |
| InChI | InChI=1S/C7H7ClN4O2/c8-3-6(13)14-12-7(9)5-4-10-1-2-11-5/h1-2,4H,3H2,(H2,9,12) |
| InChIKey | KIECOTQZCXKMAC-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.61 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[amino(pyrazin-2-yl)methylidene]amino] 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[amino(pyrazin-2-yl)methylidene]amino] 2-chloroacetate?
The IUPAC name of [[amino(pyrazin-2-yl)methylidene]amino] 2-chloroacetate (CID 4293110) is [[amino(pyrazin-2-yl)methylidene]amino] 2-chloroacetate.
What is the SMILES notation for [[amino(pyrazin-2-yl)methylidene]amino] 2-chloroacetate?
The canonical SMILES for [[amino(pyrazin-2-yl)methylidene]amino] 2-chloroacetate is NC(=NOC(=O)CCl)c1cnccn1.
What is the InChIKey of [[amino(pyrazin-2-yl)methylidene]amino] 2-chloroacetate?
The InChIKey is KIECOTQZCXKMAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN4O2/c8-3-6(13)14-12-7(9)5-4-10-1-2-11-5/h1-2,4H,3H2,(H2,9,12).
What are the key properties of [[amino(pyrazin-2-yl)methylidene]amino] 2-chloroacetate?
[[amino(pyrazin-2-yl)methylidene]amino] 2-chloroacetate has a molecular weight of 214.61 g/mol, XLogP of -0.12, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino(pyrazin-2-yl)methylidene]amino] 2-chloroacetate is sourced from PubChem (CID 4293110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).