C14H14ClN3O2S — CID 42932136
3-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]azepan-2-one (PubChem CID 42932136) has the molecular formula C14H14ClN3O2S and a molecular weight of 323.81 g/mol. Its IUPAC name is 3-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]azepan-2-one.
| Compound Name | 3-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]azepan-2-one |
|---|---|
| PubChem CID | 42932136 |
| Molecular Formula | C14H14ClN3O2S |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 3-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]azepan-2-one |
| SMILES | O=C1NCCCCC1Sc1nnc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C14H14ClN3O2S/c15-10-5-3-4-9(8-10)13-17-18-14(20-13)21-11-6-1-2-7-16-12(11)19/h3-5,8,11H,1-2,6-7H2,(H,16,19) |
| InChIKey | AEPLBNGADDNNGL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |