C14H14N2O2S — CID 7861362
(2S)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclohexan-1-one (PubChem CID 7861362) has the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. Its IUPAC name is (2S)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclohexan-1-one.
| Compound Name | (2S)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 7861362 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (2S)-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]cyclohexan-1-one |
| SMILES | O=C1CCCC[C@@H]1Sc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C14H14N2O2S/c17-11-8-4-5-9-12(11)19-14-16-15-13(18-14)10-6-2-1-3-7-10/h1-3,6-7,12H,4-5,8-9H2/t12-/m0/s1 |
| InChIKey | IZYQIIPGRWVKBC-LBPRGKRZSA-N |
| XLogP | 3.34 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |