C25H25N3O — CID 42933546
3,5-dimethyl-N-[2-(1-methylbenzimidazol-2-yl)-1-phenylethyl]benzamide (PubChem CID 42933546) has the molecular formula C25H25N3O and a molecular weight of 383.50 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-(1-methylbenzimidazol-2-yl)-1-phenylethyl]benzamide.
| Compound Name | 3,5-dimethyl-N-[2-(1-methylbenzimidazol-2-yl)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 42933546 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 3,5-dimethyl-N-[2-(1-methylbenzimidazol-2-yl)-1-phenylethyl]benzamide |
| SMILES | Cc1cc(C)cc(C(=O)NC(Cc2nc3ccccc3n2C)c2ccccc2)c1 |
| InChI | InChI=1S/C25H25N3O/c1-17-13-18(2)15-20(14-17)25(29)27-22(19-9-5-4-6-10-19)16-24-26-21-11-7-8-12-23(21)28(24)3/h4-15,22H,16H2,1-3H3,(H,27,29) |
| InChIKey | MGYKLKUGJFQXQG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |