C25H25N3O3 — CID 42933551
3,4-dimethoxy-N-[2-(1-methylbenzimidazol-2-yl)-1-phenylethyl]benzamide (PubChem CID 42933551) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-(1-methylbenzimidazol-2-yl)-1-phenylethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2-(1-methylbenzimidazol-2-yl)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 42933551 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 3,4-dimethoxy-N-[2-(1-methylbenzimidazol-2-yl)-1-phenylethyl]benzamide |
| SMILES | COc1ccc(C(=O)NC(Cc2nc3ccccc3n2C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C25H25N3O3/c1-28-21-12-8-7-11-19(21)26-24(28)16-20(17-9-5-4-6-10-17)27-25(29)18-13-14-22(30-2)23(15-18)31-3/h4-15,20H,16H2,1-3H3,(H,27,29) |
| InChIKey | NBGKISZQKCBFCH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |