C23H20N6O2S — CID 42934165
(3-methyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridin-4-yl)-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone (PubChem CID 42934165) has the molecular formula C23H20N6O2S and a molecular weight of 444.52 g/mol. Its IUPAC name is (3-methyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridin-4-yl)-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone.
| Compound Name | (3-methyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridin-4-yl)-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 42934165 |
| Molecular Formula | C23H20N6O2S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | (3-methyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridin-4-yl)-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone |
| SMILES | Cc1noc2nc(-c3cccs3)cc(C(=O)N3CCCC(c4nnc5ccccn45)C3)c12 |
| InChI | InChI=1S/C23H20N6O2S/c1-14-20-16(12-17(18-7-5-11-32-18)24-22(20)31-27-14)23(30)28-9-4-6-15(13-28)21-26-25-19-8-2-3-10-29(19)21/h2-3,5,7-8,10-12,15H,4,6,9,13H2,1H3 |
| InChIKey | YQSWZMNCALUDFU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 89.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |