C25H25FNO2+ — CID 4293448
[4-(4-fluorophenyl)-2-(2-methoxyphenyl)-4H-chromen-3-yl]methyl-dimethylazanium (PubChem CID 4293448) has the molecular formula C25H25FNO2+ and a molecular weight of 390.48 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-2-(2-methoxyphenyl)-4H-chromen-3-yl]methyl-dimethylazanium.
| Compound Name | [4-(4-fluorophenyl)-2-(2-methoxyphenyl)-4H-chromen-3-yl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 4293448 |
| Molecular Formula | C25H25FNO2+ |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | [4-(4-fluorophenyl)-2-(2-methoxyphenyl)-4H-chromen-3-yl]methyl-dimethylazanium |
| SMILES | COc1ccccc1C1=C(C[NH+](C)C)C(c2ccc(F)cc2)c2ccccc2O1 |
| InChI | InChI=1S/C25H24FNO2/c1-27(2)16-21-24(17-12-14-18(26)15-13-17)19-8-4-7-11-23(19)29-25(21)20-9-5-6-10-22(20)28-3/h4-15,24H,16H2,1-3H3/p+1 |
| InChIKey | VZKUKPWZTPYYSF-UHFFFAOYSA-O |
| XLogP | 3.91 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |