C25H23N3O4S — CID 42934924
2-(2-acetyl-1H-isoquinolin-1-yl)-N-[4-(phenylsulfamoyl)phenyl]acetamide (PubChem CID 42934924) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is 2-(2-acetyl-1H-isoquinolin-1-yl)-N-[4-(phenylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(2-acetyl-1H-isoquinolin-1-yl)-N-[4-(phenylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 42934924 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 2-(2-acetyl-1H-isoquinolin-1-yl)-N-[4-(phenylsulfamoyl)phenyl]acetamide |
| SMILES | CC(=O)N1C=Cc2ccccc2C1CC(=O)Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C25H23N3O4S/c1-18(29)28-16-15-19-7-5-6-10-23(19)24(28)17-25(30)26-20-11-13-22(14-12-20)33(31,32)27-21-8-3-2-4-9-21/h2-16,24,27H,17H2,1H3,(H,26,30) |
| InChIKey | OZFFNOPFJVICKM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |