C25H22ClN3O4S — CID 43062362
2-(2-acetyl-1H-isoquinolin-1-yl)-N-[3-[(4-chlorophenyl)sulfonylamino]phenyl]acetamide (PubChem CID 43062362) has the molecular formula C25H22ClN3O4S and a molecular weight of 495.99 g/mol. Its IUPAC name is 2-(2-acetyl-1H-isoquinolin-1-yl)-N-[3-[(4-chlorophenyl)sulfonylamino]phenyl]acetamide.
| Compound Name | 2-(2-acetyl-1H-isoquinolin-1-yl)-N-[3-[(4-chlorophenyl)sulfonylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 43062362 |
| Molecular Formula | C25H22ClN3O4S |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | 2-(2-acetyl-1H-isoquinolin-1-yl)-N-[3-[(4-chlorophenyl)sulfonylamino]phenyl]acetamide |
| SMILES | CC(=O)N1C=Cc2ccccc2C1CC(=O)Nc1cccc(NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C25H22ClN3O4S/c1-17(30)29-14-13-18-5-2-3-8-23(18)24(29)16-25(31)27-20-6-4-7-21(15-20)28-34(32,33)22-11-9-19(26)10-12-22/h2-15,24,28H,16H2,1H3,(H,27,31) |
| InChIKey | KGFFDGLYGMXFGO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |