C20H23FN4O — CID 42935387
1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[1-(4-fluorophenyl)-2-methylpropyl]urea (PubChem CID 42935387) has the molecular formula C20H23FN4O and a molecular weight of 354.43 g/mol. Its IUPAC name is 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[1-(4-fluorophenyl)-2-methylpropyl]urea.
| Compound Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[1-(4-fluorophenyl)-2-methylpropyl]urea |
|---|---|
| PubChem CID | 42935387 |
| Molecular Formula | C20H23FN4O |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[1-(4-fluorophenyl)-2-methylpropyl]urea |
| SMILES | CC(C)C(NC(=O)NCCc1nc2ccccc2[nH]1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H23FN4O/c1-13(2)19(14-7-9-15(21)10-8-14)25-20(26)22-12-11-18-23-16-5-3-4-6-17(16)24-18/h3-10,13,19H,11-12H2,1-2H3,(H,23,24)(H2,22,25,26) |
| InChIKey | QZAMJNWZDHQWFP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |