C15H22N4O3S — CID 124505879
1-[(1S)-1-(1H-benzimidazol-2-yl)-2-methylpropyl]-3-(2-methylsulfonylethyl)urea (PubChem CID 124505879) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is 1-[(1S)-1-(1H-benzimidazol-2-yl)-2-methylpropyl]-3-(2-methylsulfonylethyl)urea.
| Compound Name | 1-[(1S)-1-(1H-benzimidazol-2-yl)-2-methylpropyl]-3-(2-methylsulfonylethyl)urea |
|---|---|
| PubChem CID | 124505879 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-[(1S)-1-(1H-benzimidazol-2-yl)-2-methylpropyl]-3-(2-methylsulfonylethyl)urea |
| SMILES | CC(C)[C@H](NC(=O)NCCS(C)(=O)=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H22N4O3S/c1-10(2)13(19-15(20)16-8-9-23(3,21)22)14-17-11-6-4-5-7-12(11)18-14/h4-7,10,13H,8-9H2,1-3H3,(H,17,18)(H2,16,19,20)/t13-/m0/s1 |
| InChIKey | DHFREGWNFAFKDX-ZDUSSCGKSA-N |
| XLogP | 1.60 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |