C20H21F3N4O — CID 78888129
1-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 78888129) has the molecular formula C20H21F3N4O and a molecular weight of 390.41 g/mol. Its IUPAC name is 1-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 78888129 |
| Molecular Formula | C20H21F3N4O |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | CC(C)C(NC(=O)NCc1cccc(C(F)(F)F)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H21F3N4O/c1-12(2)17(18-25-15-8-3-4-9-16(15)26-18)27-19(28)24-11-13-6-5-7-14(10-13)20(21,22)23/h3-10,12,17H,11H2,1-2H3,(H,25,26)(H2,24,27,28) |
| InChIKey | SOKJXFDUNOYKMC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |