C20H19F3N4O3S — CID 55344925
N-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide (PubChem CID 55344925) has the molecular formula C20H19F3N4O3S and a molecular weight of 452.46 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 55344925 |
| Molecular Formula | C20H19F3N4O3S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
| SMILES | CC(C)C(NC(=O)CSc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H19F3N4O3S/c1-11(2)18(19-24-13-5-3-4-6-14(13)25-19)26-17(28)10-31-16-8-7-12(20(21,22)23)9-15(16)27(29)30/h3-9,11,18H,10H2,1-2H3,(H,24,25)(H,26,28) |
| InChIKey | UHPGDVRBXDRFHQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|