C18H17F3N4O2S — CID 42939443
N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 42939443) has the molecular formula C18H17F3N4O2S and a molecular weight of 410.42 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 42939443 |
| Molecular Formula | C18H17F3N4O2S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | CSCCC(Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H17F3N4O2S/c1-28-9-8-15(17-23-12-4-2-3-5-13(12)24-17)22-14-7-6-11(18(19,20)21)10-16(14)25(26)27/h2-7,10,15,22H,8-9H2,1H3,(H,23,24) |
| InChIKey | ILDPTSKMNDNIMJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|