C21H27N5O4S — CID 40939636
4-[[(1S)-1-(1H-benzimidazol-2-yl)-3-methylbutyl]amino]-3-nitro-N-propan-2-ylbenzenesulfonamide (PubChem CID 40939636) has the molecular formula C21H27N5O4S and a molecular weight of 445.55 g/mol. Its IUPAC name is 4-[[(1S)-1-(1H-benzimidazol-2-yl)-3-methylbutyl]amino]-3-nitro-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-[[(1S)-1-(1H-benzimidazol-2-yl)-3-methylbutyl]amino]-3-nitro-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 40939636 |
| Molecular Formula | C21H27N5O4S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 4-[[(1S)-1-(1H-benzimidazol-2-yl)-3-methylbutyl]amino]-3-nitro-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)C[C@H](Nc1ccc(S(=O)(=O)NC(C)C)cc1[N+](=O)[O-])c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H27N5O4S/c1-13(2)11-19(21-23-16-7-5-6-8-17(16)24-21)22-18-10-9-15(12-20(18)26(27)28)31(29,30)25-14(3)4/h5-10,12-14,19,22,25H,11H2,1-4H3,(H,23,24)/t19-/m0/s1 |
| InChIKey | ZFKJZYNJKIYHDQ-IBGZPJMESA-N |
| XLogP | 4.36 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|