C16H29N4O4S+ — CID 9311645
[2,2-dimethyl-3-[2-nitro-4-(propan-2-ylsulfamoyl)anilino]propyl]-dimethylazanium (PubChem CID 9311645) has the molecular formula C16H29N4O4S+ and a molecular weight of 373.50 g/mol. Its IUPAC name is [2,2-dimethyl-3-[2-nitro-4-(propan-2-ylsulfamoyl)anilino]propyl]-dimethylazanium.
| Compound Name | [2,2-dimethyl-3-[2-nitro-4-(propan-2-ylsulfamoyl)anilino]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 9311645 |
| Molecular Formula | C16H29N4O4S+ |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | [2,2-dimethyl-3-[2-nitro-4-(propan-2-ylsulfamoyl)anilino]propyl]-dimethylazanium |
| SMILES | CC(C)NS(=O)(=O)c1ccc(NCC(C)(C)C[NH+](C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H28N4O4S/c1-12(2)18-25(23,24)13-7-8-14(15(9-13)20(21)22)17-10-16(3,4)11-19(5)6/h7-9,12,17-18H,10-11H2,1-6H3/p+1 |
| InChIKey | SHZBIJLDGHMACP-UHFFFAOYSA-O |
| XLogP | 0.86 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|