C21H23N5O3 — CID 55943106
N-[(1S)-1-(1H-benzimidazol-2-yl)-2-methylpropyl]-4-(cyclopropylamino)-3-nitrobenzamide (PubChem CID 55943106) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is N-[(1S)-1-(1H-benzimidazol-2-yl)-2-methylpropyl]-4-(cyclopropylamino)-3-nitrobenzamide.
| Compound Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-2-methylpropyl]-4-(cyclopropylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 55943106 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-2-methylpropyl]-4-(cyclopropylamino)-3-nitrobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(NC2CC2)c([N+](=O)[O-])c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H23N5O3/c1-12(2)19(20-23-15-5-3-4-6-16(15)24-20)25-21(27)13-7-10-17(22-14-8-9-14)18(11-13)26(28)29/h3-7,10-12,14,19,22H,8-9H2,1-2H3,(H,23,24)(H,25,27)/t19-/m0/s1 |
| InChIKey | SPCYHTSRDQPFPZ-IBGZPJMESA-N |
| XLogP | 4.17 |
| TPSA | 112.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|