C23H28N4O3S — CID 55938807
N-[(1S)-1-(1H-benzimidazol-2-yl)-2-methylpropyl]-3-(cyclopentylsulfamoyl)benzamide (PubChem CID 55938807) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is N-[(1S)-1-(1H-benzimidazol-2-yl)-2-methylpropyl]-3-(cyclopentylsulfamoyl)benzamide.
| Compound Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-2-methylpropyl]-3-(cyclopentylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55938807 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-2-methylpropyl]-3-(cyclopentylsulfamoyl)benzamide |
| SMILES | CC(C)[C@H](NC(=O)c1cccc(S(=O)(=O)NC2CCCC2)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H28N4O3S/c1-15(2)21(22-24-19-12-5-6-13-20(19)25-22)26-23(28)16-8-7-11-18(14-16)31(29,30)27-17-9-3-4-10-17/h5-8,11-15,17,21,27H,3-4,9-10H2,1-2H3,(H,24,25)(H,26,28)/t21-/m0/s1 |
| InChIKey | CCWLNNMZKCEGNI-NRFANRHFSA-N |
| XLogP | 3.91 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |