C29H38N6O — CID 42936124
1-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]ethanone (PubChem CID 42936124) has the molecular formula C29H38N6O and a molecular weight of 486.66 g/mol. Its IUPAC name is 1-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]ethanone.
| Compound Name | 1-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 42936124 |
| Molecular Formula | C29H38N6O |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | 1-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]ethanone |
| SMILES | O=C(CN1CCCC(c2nnc3n2CCCCC3)C1)N1CCN(Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C29H38N6O/c36-28(22-33-14-7-11-25(21-33)29-31-30-27-13-2-1-5-15-35(27)29)34-18-16-32(17-19-34)20-24-10-6-9-23-8-3-4-12-26(23)24/h3-4,6,8-10,12,25H,1-2,5,7,11,13-22H2 |
| InChIKey | JSRVJCULIDCCHL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |