C21H25N5OS — CID 42939838
1-[3H-benzimidazol-5-yl(phenyl)methyl]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 42939838) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is 1-[3H-benzimidazol-5-yl(phenyl)methyl]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[3H-benzimidazol-5-yl(phenyl)methyl]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 42939838 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-[3H-benzimidazol-5-yl(phenyl)methyl]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | S=C(NCCN1CCOCC1)NC(c1ccccc1)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C21H25N5OS/c28-21(22-8-9-26-10-12-27-13-11-26)25-20(16-4-2-1-3-5-16)17-6-7-18-19(14-17)24-15-23-18/h1-7,14-15,20H,8-13H2,(H,23,24)(H2,22,25,28) |
| InChIKey | DADKAHAREAYVRJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|