C16H23Cl2N3O2 — CID 42940169
3,6-dichloro-N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]pyridine-2-carboxamide (PubChem CID 42940169) has the molecular formula C16H23Cl2N3O2 and a molecular weight of 360.29 g/mol. Its IUPAC name is 3,6-dichloro-N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 42940169 |
| Molecular Formula | C16H23Cl2N3O2 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 3,6-dichloro-N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]pyridine-2-carboxamide |
| SMILES | CC1CN(C(C)(C)CNC(=O)c2nc(Cl)ccc2Cl)CC(C)O1 |
| InChI | InChI=1S/C16H23Cl2N3O2/c1-10-7-21(8-11(2)23-10)16(3,4)9-19-15(22)14-12(17)5-6-13(18)20-14/h5-6,10-11H,7-9H2,1-4H3,(H,19,22) |
| InChIKey | AVONZBNIBCQSAQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|