C20H32N4OS — CID 42941612
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 42941612) has the molecular formula C20H32N4OS and a molecular weight of 376.57 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 42941612 |
| Molecular Formula | C20H32N4OS |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | O=C(CSc1n[nH]c(CCC2CCCC2)n1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C20H32N4OS/c25-19(24-13-5-9-16-8-3-4-10-17(16)24)14-26-20-21-18(22-23-20)12-11-15-6-1-2-7-15/h15-17H,1-14H2,(H,21,22,23) |
| InChIKey | MVBGQBROWGYGPG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |