C19H24FN3OS — CID 24651919
4-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-(4-fluorophenyl)butan-1-one (PubChem CID 24651919) has the molecular formula C19H24FN3OS and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-(4-fluorophenyl)butan-1-one.
| Compound Name | 4-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 24651919 |
| Molecular Formula | C19H24FN3OS |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 4-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-(4-fluorophenyl)butan-1-one |
| SMILES | O=C(CCCSc1n[nH]c(CCC2CCCC2)n1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H24FN3OS/c20-16-10-8-15(9-11-16)17(24)6-3-13-25-19-21-18(22-23-19)12-7-14-4-1-2-5-14/h8-11,14H,1-7,12-13H2,(H,21,22,23) |
| InChIKey | FKSUKZSGSXTWGU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|