C21H28N4O2S — CID 55578499
N-(2-acetylphenyl)-4-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]butanamide (PubChem CID 55578499) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is N-(2-acetylphenyl)-4-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]butanamide.
| Compound Name | N-(2-acetylphenyl)-4-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 55578499 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-(2-acetylphenyl)-4-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]butanamide |
| SMILES | CC(=O)c1ccccc1NC(=O)CCCSc1n[nH]c(CCC2CCCC2)n1 |
| InChI | InChI=1S/C21H28N4O2S/c1-15(26)17-9-4-5-10-18(17)22-20(27)11-6-14-28-21-23-19(24-25-21)13-12-16-7-2-3-8-16/h4-5,9-10,16H,2-3,6-8,11-14H2,1H3,(H,22,27)(H,23,24,25) |
| InChIKey | KCTRDQVKTLAVTE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|