C18H19BrN4O2 — CID 42942337
1-(4-bromophenyl)-N-[6-(dimethylamino)-3-pyridinyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 42942337) has the molecular formula C18H19BrN4O2 and a molecular weight of 403.28 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[6-(dimethylamino)-3-pyridinyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[6-(dimethylamino)-3-pyridinyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42942337 |
| Molecular Formula | C18H19BrN4O2 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 1-(4-bromophenyl)-N-[6-(dimethylamino)-3-pyridinyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)C2CC(=O)N(c3ccc(Br)cc3)C2)cn1 |
| InChI | InChI=1S/C18H19BrN4O2/c1-22(2)16-8-5-14(10-20-16)21-18(25)12-9-17(24)23(11-12)15-6-3-13(19)4-7-15/h3-8,10,12H,9,11H2,1-2H3,(H,21,25) |
| InChIKey | VYXAPZTXQODLDC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |