C17H14BrIN2O2 — CID 1286829
(3S)-1-(4-bromophenyl)-N-(4-iodophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 1286829) has the molecular formula C17H14BrIN2O2 and a molecular weight of 485.12 g/mol. Its IUPAC name is (3S)-1-(4-bromophenyl)-N-(4-iodophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(4-bromophenyl)-N-(4-iodophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 1286829 |
| Molecular Formula | C17H14BrIN2O2 |
| Molecular Weight | 485.12 g/mol |
| Exact Mass | 483.93 |
| IUPAC Name | (3S)-1-(4-bromophenyl)-N-(4-iodophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)[C@H]1CC(=O)N(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C17H14BrIN2O2/c18-12-1-7-15(8-2-12)21-10-11(9-16(21)22)17(23)20-14-5-3-13(19)4-6-14/h1-8,11H,9-10H2,(H,20,23)/t11-/m0/s1 |
| InChIKey | YKIOXXHFNLNWSD-NSHDSACASA-N |
| XLogP | 4.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.12 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|