C18H17BrN4O3 — CID 46196744
1-[[1-(4-bromophenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-phenylurea (PubChem CID 46196744) has the molecular formula C18H17BrN4O3 and a molecular weight of 417.26 g/mol. Its IUPAC name is 1-[[1-(4-bromophenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-phenylurea.
| Compound Name | 1-[[1-(4-bromophenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-phenylurea |
|---|---|
| PubChem CID | 46196744 |
| Molecular Formula | C18H17BrN4O3 |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 1-[[1-(4-bromophenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-phenylurea |
| SMILES | O=C(NNC(=O)C1CC(=O)N(c2ccc(Br)cc2)C1)Nc1ccccc1 |
| InChI | InChI=1S/C18H17BrN4O3/c19-13-6-8-15(9-7-13)23-11-12(10-16(23)24)17(25)21-22-18(26)20-14-4-2-1-3-5-14/h1-9,12H,10-11H2,(H,21,25)(H2,20,22,26) |
| InChIKey | VVJXUEQONUPUPO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|