C36H41BrN2O4S — CID 4294246
propan-2-yl 2-[[6-bromo-2-(4-ethoxyphenyl)quinoline-4-carbonyl]amino]-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophene-3-carboxylate (PubChem CID 4294246) has the molecular formula C36H41BrN2O4S and a molecular weight of 677.71 g/mol. Its IUPAC name is propan-2-yl 2-[[6-bromo-2-(4-ethoxyphenyl)quinoline-4-carbonyl]amino]-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[[6-bromo-2-(4-ethoxyphenyl)quinoline-4-carbonyl]amino]-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4294246 |
| Molecular Formula | C36H41BrN2O4S |
| Molecular Weight | 677.71 g/mol |
| Exact Mass | 676.20 |
| IUPAC Name | propan-2-yl 2-[[6-bromo-2-(4-ethoxyphenyl)quinoline-4-carbonyl]amino]-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophene-3-carboxylate |
| SMILES | CCOc1ccc(-c2cc(C(=O)Nc3sc4c(c3C(=O)OC(C)C)CCCCCCCCCC4)c3cc(Br)ccc3n2)cc1 |
| InChI | InChI=1S/C36H41BrN2O4S/c1-4-42-26-18-15-24(16-19-26)31-22-29(28-21-25(37)17-20-30(28)38-31)34(40)39-35-33(36(41)43-23(2)3)27-13-11-9-7-5-6-8-10-12-14-32(27)44-35/h15-23H,4-14H2,1-3H3,(H,39,40) |
| InChIKey | HOVMSCAHSORINY-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.71 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |